C19H11N3O2 — CID 10267564
15-(1H-imidazol-2-yl)-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,10,12-heptaene-14,16-dione (PubChem CID 10267564) has the molecular formula C19H11N3O2 and a molecular weight of 313.32 g/mol. Its IUPAC name is 15-(1H-imidazol-2-yl)-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,10,12-heptaene-14,16-dione.
| Compound Name | 15-(1H-imidazol-2-yl)-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,10,12-heptaene-14,16-dione |
|---|---|
| PubChem CID | 10267564 |
| Molecular Formula | C19H11N3O2 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 15-(1H-imidazol-2-yl)-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,10,12-heptaene-14,16-dione |
| SMILES | O=C1c2cccc3cc4ccccc4c(c23)C(=O)N1c1ncc[nH]1 |
| InChI | InChI=1S/C19H11N3O2/c23-17-14-7-3-5-12-10-11-4-1-2-6-13(11)16(15(12)14)18(24)22(17)19-20-8-9-21-19/h1-10H,(H,20,21) |
| InChIKey | WXKNUFXBBNOMTM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|