C23H29BF2N2O — CID 139176522
8-[2,6-di(propan-2-yl)phenyl]-7,7-difluoro-5,5-dimethyl-3-oxa-8-aza-6-azonia-7-boranuidatricyclo[7.4.0.02,6]trideca-1(13),2(6),9,11-tetraene (PubChem CID 139176522) has the molecular formula C23H29BF2N2O and a molecular weight of 398.31 g/mol. Its IUPAC name is 8-[2,6-di(propan-2-yl)phenyl]-7,7-difluoro-5,5-dimethyl-3-oxa-8-aza-6-azonia-7-boranuidatricyclo[7.4.0.02,6]trideca-1(13),2(6),9,11-tetraene.
| Compound Name | 8-[2,6-di(propan-2-yl)phenyl]-7,7-difluoro-5,5-dimethyl-3-oxa-8-aza-6-azonia-7-boranuidatricyclo[7.4.0.02,6]trideca-1(13),2(6),9,11-tetraene |
|---|---|
| PubChem CID | 139176522 |
| Molecular Formula | C23H29BF2N2O |
| Molecular Weight | 398.31 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | 8-[2,6-di(propan-2-yl)phenyl]-7,7-difluoro-5,5-dimethyl-3-oxa-8-aza-6-azonia-7-boranuidatricyclo[7.4.0.02,6]trideca-1(13),2(6),9,11-tetraene |
| SMILES | CC(C)c1cccc(C(C)C)c1N1c2ccccc2C2=[N+]([B-]1(F)F)C(C)(C)CO2 |
| InChI | InChI=1S/C23H29BF2N2O/c1-15(2)17-11-9-12-18(16(3)4)21(17)27-20-13-8-7-10-19(20)22-28(24(27,25)26)23(5,6)14-29-22/h7-13,15-16H,14H2,1-6H3 |
| InChIKey | MEPUULLXKRRCBP-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 15.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.31 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|