C26H18CuN4O2 — CID 139177738
copper;(NE,Z)-N-[(2-oxidophenyl)methylidene]benzenecarbohydrazonate;1,10-phenanthroline (PubChem CID 139177738) has the molecular formula C26H18CuN4O2 and a molecular weight of 482.00 g/mol. Its IUPAC name is copper;(NE,Z)-N-[(2-oxidophenyl)methylidene]benzenecarbohydrazonate;1,10-phenanthroline.
| Compound Name | copper;(NE,Z)-N-[(2-oxidophenyl)methylidene]benzenecarbohydrazonate;1,10-phenanthroline |
|---|---|
| PubChem CID | 139177738 |
| Molecular Formula | C26H18CuN4O2 |
| Molecular Weight | 482.00 g/mol |
| Exact Mass | 481.07 |
| IUPAC Name | copper;(NE,Z)-N-[(2-oxidophenyl)methylidene]benzenecarbohydrazonate;1,10-phenanthroline |
| SMILES | [Cu+2].[O-]/C(=N\N=C\c1ccccc1[O-])c1ccccc1.c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C14H12N2O2.C12H8N2.Cu/c17-13-9-5-4-8-12(13)10-15-16-14(18)11-6-2-1-3-7-11;1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;/h1-10,17H,(H,16,18);1-8H;/q;;+2/p-2/b15-10+;; |
| InChIKey | AXCJHIOLGJQTSN-OVWKBUNZSA-L |
| XLogP | 3.68 |
| TPSA | 96.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.00 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|