C22H15DyF3N2O2 — CID 59381361
dysprosium;1,10-phenanthroline;(Z)-1,1,1-trifluoro-4-hydroxy-4-phenylbut-3-en-2-one (PubChem CID 59381361) has the molecular formula C22H15DyF3N2O2 and a molecular weight of 558.87 g/mol. Its IUPAC name is dysprosium;1,10-phenanthroline;(Z)-1,1,1-trifluoro-4-hydroxy-4-phenylbut-3-en-2-one.
| Compound Name | dysprosium;1,10-phenanthroline;(Z)-1,1,1-trifluoro-4-hydroxy-4-phenylbut-3-en-2-one |
|---|---|
| PubChem CID | 59381361 |
| Molecular Formula | C22H15DyF3N2O2 |
| Molecular Weight | 558.87 g/mol |
| Exact Mass | 560.04 |
| IUPAC Name | dysprosium;1,10-phenanthroline;(Z)-1,1,1-trifluoro-4-hydroxy-4-phenylbut-3-en-2-one |
| SMILES | O=C(/C=C(\O)c1ccccc1)C(F)(F)F.[Dy].c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C12H8N2.C10H7F3O2.Dy/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;11-10(12,13)9(15)6-8(14)7-4-2-1-3-5-7;/h1-8H;1-6,14H;/b;8-6-; |
| InChIKey | JHDCYNWUVFLDGZ-QBUDOIDPSA-N |
| XLogP | 5.50 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.87 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|