C34H20CoF6N4O4 — CID 139240245
cobalt(2+);pyrazino[2,3-f][1,10]phenanthroline;bis((Z)-4,4,4-trifluoro-3-oxo-1-phenylbut-1-en-1-olate) (PubChem CID 139240245) has the molecular formula C34H20CoF6N4O4 and a molecular weight of 721.48 g/mol. Its IUPAC name is cobalt(2+);pyrazino[2,3-f][1,10]phenanthroline;bis((Z)-4,4,4-trifluoro-3-oxo-1-phenylbut-1-en-1-olate).
| Compound Name | cobalt(2+);pyrazino[2,3-f][1,10]phenanthroline;bis((Z)-4,4,4-trifluoro-3-oxo-1-phenylbut-1-en-1-olate) |
|---|---|
| PubChem CID | 139240245 |
| Molecular Formula | C34H20CoF6N4O4 |
| Molecular Weight | 721.48 g/mol |
| Exact Mass | 721.07 |
| IUPAC Name | cobalt(2+);pyrazino[2,3-f][1,10]phenanthroline;bis((Z)-4,4,4-trifluoro-3-oxo-1-phenylbut-1-en-1-olate) |
| SMILES | O=C(/C=C(\[O-])c1ccccc1)C(F)(F)F.O=C(/C=C(\[O-])c1ccccc1)C(F)(F)F.[Co+2].c1cnc2c(c1)c1nccnc1c1cccnc12 |
| InChI | InChI=1S/C14H8N4.2C10H7F3O2.Co/c1-3-9-11(15-5-1)12-10(4-2-6-16-12)14-13(9)17-7-8-18-14;2*11-10(12,13)9(15)6-8(14)7-4-2-1-3-5-7;/h1-8H;2*1-6,14H;/q;;;+2/p-2/b;2*8-6-; |
| InChIKey | DOYGVBGAIDKDFE-VNONHLNDSA-L |
| XLogP | 5.76 |
| TPSA | 131.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.48 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|