C26H18N4O2 — CID 136610168
2-[[6-[(2-hydroxyphenyl)methylideneamino]-1,10-phenanthrolin-5-yl]iminomethyl]phenol (PubChem CID 136610168) has the molecular formula C26H18N4O2 and a molecular weight of 418.46 g/mol. Its IUPAC name is 2-[[6-[(2-hydroxyphenyl)methylideneamino]-1,10-phenanthrolin-5-yl]iminomethyl]phenol.
| Compound Name | 2-[[6-[(2-hydroxyphenyl)methylideneamino]-1,10-phenanthrolin-5-yl]iminomethyl]phenol |
|---|---|
| PubChem CID | 136610168 |
| Molecular Formula | C26H18N4O2 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 2-[[6-[(2-hydroxyphenyl)methylideneamino]-1,10-phenanthrolin-5-yl]iminomethyl]phenol |
| SMILES | Oc1ccccc1/C=N/c1c(/N=C/c2ccccc2O)c2cccnc2c2ncccc12 |
| InChI | InChI=1S/C26H18N4O2/c31-21-11-3-1-7-17(21)15-29-25-19-9-5-13-27-23(19)24-20(10-6-14-28-24)26(25)30-16-18-8-2-4-12-22(18)32/h1-16,31-32H/b29-15+,30-16+ |
| InChIKey | AJVFTWVMMSHOND-CMNXJCJSSA-N |
| XLogP | 5.70 |
| TPSA | 90.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|