C42H38DyF21N2O6 — CID 139201596
dysprosium(3+);tris((Z)-1,1,1,2,2,3,3-heptafluoro-7,7-dimethyl-6-oxooct-4-en-4-olate);1,10-phenanthroline (PubChem CID 139201596) has the molecular formula C42H38DyF21N2O6 and a molecular weight of 1228.23 g/mol. Its IUPAC name is dysprosium(3+);tris((Z)-1,1,1,2,2,3,3-heptafluoro-7,7-dimethyl-6-oxooct-4-en-4-olate);1,10-phenanthroline.
| Compound Name | dysprosium(3+);tris((Z)-1,1,1,2,2,3,3-heptafluoro-7,7-dimethyl-6-oxooct-4-en-4-olate);1,10-phenanthroline |
|---|---|
| PubChem CID | 139201596 |
| Molecular Formula | C42H38DyF21N2O6 |
| Molecular Weight | 1228.23 g/mol |
| Exact Mass | 1229.17 |
| IUPAC Name | dysprosium(3+);tris((Z)-1,1,1,2,2,3,3-heptafluoro-7,7-dimethyl-6-oxooct-4-en-4-olate);1,10-phenanthroline |
| SMILES | CC(C)(C)C(=O)/C=C(\[O-])C(F)(F)C(F)(F)C(F)(F)F.CC(C)(C)C(=O)/C=C(\[O-])C(F)(F)C(F)(F)C(F)(F)F.CC(C)(C)C(=O)/C=C(\[O-])C(F)(F)C(F)(F)C(F)(F)F.[Dy+3].c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C12H8N2.3C10H11F7O2.Dy/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;3*1-7(2,3)5(18)4-6(19)8(11,12)9(13,14)10(15,16)17;/h1-8H;3*4,19H,1-3H3;/q;;;;+3/p-3/b;3*6-4-; |
| InChIKey | KHIFUGHSTSVZNC-XRPAYOKVSA-K |
| XLogP | 10.82 |
| TPSA | 146.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1228.23 |
| LogP ≤ 5 | 10.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|