C34H32F6N4O2Zn — CID 139165159
zinc bis((Z)-6,6,6-trifluoro-2,2-dimethyl-5-quinolin-8-yliminohex-3-en-3-olate) (PubChem CID 139165159) has the molecular formula C34H32F6N4O2Zn and a molecular weight of 708.03 g/mol. Its IUPAC name is zinc bis((Z)-6,6,6-trifluoro-2,2-dimethyl-5-quinolin-8-yliminohex-3-en-3-olate).
| Compound Name | zinc bis((Z)-6,6,6-trifluoro-2,2-dimethyl-5-quinolin-8-yliminohex-3-en-3-olate) |
|---|---|
| PubChem CID | 139165159 |
| Molecular Formula | C34H32F6N4O2Zn |
| Molecular Weight | 708.03 g/mol |
| Exact Mass | 706.17 |
| IUPAC Name | zinc bis((Z)-6,6,6-trifluoro-2,2-dimethyl-5-quinolin-8-yliminohex-3-en-3-olate) |
| SMILES | CC(C)(C)/C([O-])=C/C(=N/c1cccc2cccnc12)C(F)(F)F.CC(C)(C)/C([O-])=C/C(=Nc1cccc2cccnc12)C(F)(F)F.[Zn+2] |
| InChI | InChI=1S/2C17H17F3N2O.Zn/c2*1-16(2,3)14(23)10-13(17(18,19)20)22-12-8-4-6-11-7-5-9-21-15(11)12;/h2*4-10,23H,1-3H3;/q;;+2/p-2/b14-10-,22-13?;14-10-,22-13-; |
| InChIKey | NOEPSCUFMCIBMC-JHWZGIOWSA-L |
| XLogP | 8.32 |
| TPSA | 96.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.03 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|