C14H16ClN3OPt — CID 11561912
2-amino-3-methyl-N-quinolin-8-ylbutanimidate;chloroplatinum(1+) (PubChem CID 11561912) has the molecular formula C14H16ClN3OPt and a molecular weight of 472.83 g/mol. Its IUPAC name is 2-amino-3-methyl-N-quinolin-8-ylbutanimidate;chloroplatinum(1+).
| Compound Name | 2-amino-3-methyl-N-quinolin-8-ylbutanimidate;chloroplatinum(1+) |
|---|---|
| PubChem CID | 11561912 |
| Molecular Formula | C14H16ClN3OPt |
| Molecular Weight | 472.83 g/mol |
| Exact Mass | 472.06 |
| IUPAC Name | 2-amino-3-methyl-N-quinolin-8-ylbutanimidate;chloroplatinum(1+) |
| SMILES | CC(C)C(N)/C([O-])=N/c1cccc2cccnc12.Cl[Pt+] |
| InChI | InChI=1S/C14H17N3O.ClH.Pt/c1-9(2)12(15)14(18)17-11-7-3-5-10-6-4-8-16-13(10)11;;/h3-9,12H,15H2,1-2H3,(H,17,18);1H;/q;;+2/p-2 |
| InChIKey | STFKMHVNSHLAAF-UHFFFAOYSA-L |
| XLogP | 2.30 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.83 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|