C19H24ClN3O3PtS — CID 15971390
chloroplatinum(1+);(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanyl-N-quinolin-8-ylbutanimidate (PubChem CID 15971390) has the molecular formula C19H24ClN3O3PtS and a molecular weight of 605.02 g/mol. Its IUPAC name is chloroplatinum(1+);(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanyl-N-quinolin-8-ylbutanimidate.
| Compound Name | chloroplatinum(1+);(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanyl-N-quinolin-8-ylbutanimidate |
|---|---|
| PubChem CID | 15971390 |
| Molecular Formula | C19H24ClN3O3PtS |
| Molecular Weight | 605.02 g/mol |
| Exact Mass | 604.09 |
| IUPAC Name | chloroplatinum(1+);(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanyl-N-quinolin-8-ylbutanimidate |
| SMILES | CSCC[C@H](NC(=O)OC(C)(C)C)/C([O-])=N/c1cccc2cccnc12.Cl[Pt+] |
| InChI | InChI=1S/C19H25N3O3S.ClH.Pt/c1-19(2,3)25-18(24)22-15(10-12-26-4)17(23)21-14-9-5-7-13-8-6-11-20-16(13)14;;/h5-9,11,15H,10,12H2,1-4H3,(H,21,23)(H,22,24);1H;/q;;+2/p-2/t15-;;/m0../s1 |
| InChIKey | BYRACNLCJKDCHI-CKUXDGONSA-L |
| XLogP | 3.96 |
| TPSA | 86.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.02 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|