C32H39F3N2O2Zn — CID 139160118
zinc;2,6-ditert-butylphenolate;(Z)-6,6,6-trifluoro-2,2-dimethyl-5-(2-methylquinolin-8-yl)iminohex-3-en-3-olate (PubChem CID 139160118) has the molecular formula C32H39F3N2O2Zn and a molecular weight of 606.06 g/mol. Its IUPAC name is zinc;2,6-ditert-butylphenolate;(Z)-6,6,6-trifluoro-2,2-dimethyl-5-(2-methylquinolin-8-yl)iminohex-3-en-3-olate.
| Compound Name | zinc;2,6-ditert-butylphenolate;(Z)-6,6,6-trifluoro-2,2-dimethyl-5-(2-methylquinolin-8-yl)iminohex-3-en-3-olate |
|---|---|
| PubChem CID | 139160118 |
| Molecular Formula | C32H39F3N2O2Zn |
| Molecular Weight | 606.06 g/mol |
| Exact Mass | 604.23 |
| IUPAC Name | zinc;2,6-ditert-butylphenolate;(Z)-6,6,6-trifluoro-2,2-dimethyl-5-(2-methylquinolin-8-yl)iminohex-3-en-3-olate |
| SMILES | CC(C)(C)c1cccc(C(C)(C)C)c1[O-].Cc1ccc2cccc(/N=C(/C=C(\[O-])C(C)(C)C)C(F)(F)F)c2n1.[Zn+2] |
| InChI | InChI=1S/C18H19F3N2O.C14H22O.Zn/c1-11-8-9-12-6-5-7-13(16(12)22-11)23-14(18(19,20)21)10-15(24)17(2,3)4;1-13(2,3)10-8-7-9-11(12(10)15)14(4,5)6;/h5-10,24H,1-4H3;7-9,15H,1-6H3;/q;;+2/p-2/b15-10-,23-14-;; |
| InChIKey | MPJFHPRGGYKPIZ-FFKNXIBVSA-L |
| XLogP | 7.82 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.06 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|