C30H18F12N4O2Zn — CID 139165162
zinc bis((Z)-1,1,1,5,5,5-hexafluoro-4-(2-methylquinolin-8-yl)iminopent-2-en-2-olate) (PubChem CID 139165162) has the molecular formula C30H18F12N4O2Zn and a molecular weight of 759.87 g/mol. Its IUPAC name is zinc bis((Z)-1,1,1,5,5,5-hexafluoro-4-(2-methylquinolin-8-yl)iminopent-2-en-2-olate).
| Compound Name | zinc bis((Z)-1,1,1,5,5,5-hexafluoro-4-(2-methylquinolin-8-yl)iminopent-2-en-2-olate) |
|---|---|
| PubChem CID | 139165162 |
| Molecular Formula | C30H18F12N4O2Zn |
| Molecular Weight | 759.87 g/mol |
| Exact Mass | 758.05 |
| IUPAC Name | zinc bis((Z)-1,1,1,5,5,5-hexafluoro-4-(2-methylquinolin-8-yl)iminopent-2-en-2-olate) |
| SMILES | Cc1ccc2cccc(/N=C(/C=C(\[O-])C(F)(F)F)C(F)(F)F)c2n1.Cc1ccc2cccc(N=C(/C=C(\[O-])C(F)(F)F)C(F)(F)F)c2n1.[Zn+2] |
| InChI | InChI=1S/2C15H10F6N2O.Zn/c2*1-8-5-6-9-3-2-4-10(13(9)22-8)23-11(14(16,17)18)7-12(24)15(19,20)21;/h2*2-7,24H,1H3;/q;;+2/p-2/b12-7-,23-11?;12-7-,23-11-; |
| InChIKey | IYKWTFPOHZBEFW-BNLQICICSA-L |
| XLogP | 7.97 |
| TPSA | 96.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.87 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|