About CID 6371660
CID 6371660 (PubChem CID 6371660) has the molecular formula C20H18N2O2Sn
and a molecular weight of 437.09 g/mol.
Molecular Properties
| Compound Name | CID 6371660 |
| PubChem CID | 6371660 |
| Molecular Formula | C20H18N2O2Sn |
| Molecular Weight | 437.09 g/mol |
| Exact Mass | 438.04 |
| IUPAC Name | — |
| SMILES | Cc1ccc2cccc(O)c2n1.Cc1ccc2cccc(O)c2n1.[Sn] |
| InChI | InChI=1S/2C10H9NO.Sn/c2*1-7-5-6-8-3-2-4-9(12)10(8)11-7;/h2*2-6,12H,1H3; |
| InChIKey | ZVFGRAURIJLTNE-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.09 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 6371660 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 6371660?
The IUPAC name of CID 6371660 (CID 6371660) is not available.
What is the SMILES notation for CID 6371660?
The canonical SMILES for CID 6371660 is Cc1ccc2cccc(O)c2n1.Cc1ccc2cccc(O)c2n1.[Sn].
What is the InChIKey of CID 6371660?
The InChIKey is ZVFGRAURIJLTNE-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H9NO.Sn/c2*1-7-5-6-8-3-2-4-9(12)10(8)11-7;/h2*2-6,12H,1H3;.
What are the key properties of CID 6371660?
CID 6371660 has a molecular weight of 437.09 g/mol, XLogP of 4.12, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 6371660 is sourced from PubChem (CID 6371660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).