About bis(2-methylquinolin-8-ol);naphthalene-1-carboxylic acid
bis(2-methylquinolin-8-ol);naphthalene-1-carboxylic acid (PubChem CID 175208993) has the molecular formula C31H26N2O4
and a molecular weight of 490.56 g/mol. Its IUPAC name is bis(2-methylquinolin-8-ol);naphthalene-1-carboxylic acid.
Molecular Properties
| Compound Name | bis(2-methylquinolin-8-ol);naphthalene-1-carboxylic acid |
| PubChem CID | 175208993 |
| Molecular Formula | C31H26N2O4 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | bis(2-methylquinolin-8-ol);naphthalene-1-carboxylic acid |
| SMILES | Cc1ccc2cccc(O)c2n1.Cc1ccc2cccc(O)c2n1.O=C(O)c1cccc2ccccc12 |
| InChI | InChI=1S/C11H8O2.2C10H9NO/c12-11(13)10-7-3-5-8-4-1-2-6-9(8)10;2*1-7-5-6-8-3-2-4-9(12)10(8)11-7/h1-7H,(H,12,13);2*2-6,12H,1H3 |
| InChIKey | LBUXLLWNIIKCQS-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze bis(2-methylquinolin-8-ol);naphthalene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-methylquinolin-8-ol);naphthalene-1-carboxylic acid?
The IUPAC name of bis(2-methylquinolin-8-ol);naphthalene-1-carboxylic acid (CID 175208993) is bis(2-methylquinolin-8-ol);naphthalene-1-carboxylic acid.
What is the SMILES notation for bis(2-methylquinolin-8-ol);naphthalene-1-carboxylic acid?
The canonical SMILES for bis(2-methylquinolin-8-ol);naphthalene-1-carboxylic acid is Cc1ccc2cccc(O)c2n1.Cc1ccc2cccc(O)c2n1.O=C(O)c1cccc2ccccc12.
What is the InChIKey of bis(2-methylquinolin-8-ol);naphthalene-1-carboxylic acid?
The InChIKey is LBUXLLWNIIKCQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8O2.2C10H9NO/c12-11(13)10-7-3-5-8-4-1-2-6-9(8)10;2*1-7-5-6-8-3-2-4-9(12)10(8)11-7/h1-7H,(H,12,13);2*2-6,12H,1H3.
What are the key properties of bis(2-methylquinolin-8-ol);naphthalene-1-carboxylic acid?
bis(2-methylquinolin-8-ol);naphthalene-1-carboxylic acid has a molecular weight of 490.56 g/mol, XLogP of 7.04, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methylquinolin-8-ol);naphthalene-1-carboxylic acid is sourced from PubChem (CID 175208993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).