C16H10Cl2N2O — CID 139178652
6-chloro-14-(2-chloroethyl)-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9(16),10,12-heptaen-8-one (PubChem CID 139178652) has the molecular formula C16H10Cl2N2O and a molecular weight of 317.18 g/mol. Its IUPAC name is 6-chloro-14-(2-chloroethyl)-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9(16),10,12-heptaen-8-one.
| Compound Name | 6-chloro-14-(2-chloroethyl)-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9(16),10,12-heptaen-8-one |
|---|---|
| PubChem CID | 139178652 |
| Molecular Formula | C16H10Cl2N2O |
| Molecular Weight | 317.18 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | 6-chloro-14-(2-chloroethyl)-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9(16),10,12-heptaen-8-one |
| SMILES | O=C1c2c(Cl)cccc2-c2nn(CCCl)c3cccc1c23 |
| InChI | InChI=1S/C16H10Cl2N2O/c17-7-8-20-12-6-2-4-10-14(12)15(19-20)9-3-1-5-11(18)13(9)16(10)21/h1-6H,7-8H2 |
| InChIKey | KZVZQCGGVMFVJZ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.18 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|