C14H10ClNO3 — CID 13237905
5-chloro-2-(2-hydroxyethyl)benzo[f]isoindole-4,9-dione (PubChem CID 13237905) has the molecular formula C14H10ClNO3 and a molecular weight of 275.69 g/mol. Its IUPAC name is 5-chloro-2-(2-hydroxyethyl)benzo[f]isoindole-4,9-dione.
| Compound Name | 5-chloro-2-(2-hydroxyethyl)benzo[f]isoindole-4,9-dione |
|---|---|
| PubChem CID | 13237905 |
| Molecular Formula | C14H10ClNO3 |
| Molecular Weight | 275.69 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | 5-chloro-2-(2-hydroxyethyl)benzo[f]isoindole-4,9-dione |
| SMILES | O=C1c2cn(CCO)cc2C(=O)c2c(Cl)cccc21 |
| InChI | InChI=1S/C14H10ClNO3/c15-11-3-1-2-8-12(11)14(19)10-7-16(4-5-17)6-9(10)13(8)18/h1-3,6-7,17H,4-5H2 |
| InChIKey | FUPWDUSCPKPPJU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.69 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|