C76H64F26N2O10 — CID 139179896
2-[2-[2-(6-hexoxynaphthalen-2-yl)oxyethoxy]ethyl]-6-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)benzo[de]isoquinoline-1,3-dione (PubChem CID 139179896) has the molecular formula C76H64F26N2O10 and a molecular weight of 1659.30 g/mol. Its IUPAC name is 2-[2-[2-(6-hexoxynaphthalen-2-yl)oxyethoxy]ethyl]-6-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[2-[2-(6-hexoxynaphthalen-2-yl)oxyethoxy]ethyl]-6-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 139179896 |
| Molecular Formula | C76H64F26N2O10 |
| Molecular Weight | 1659.30 g/mol |
| Exact Mass | 1658.41 |
| IUPAC Name | 2-[2-[2-(6-hexoxynaphthalen-2-yl)oxyethoxy]ethyl]-6-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)benzo[de]isoquinoline-1,3-dione |
| SMILES | CCCCCCOc1ccc2cc(OCCOCCN3C(=O)c4cccc5c(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)ccc(c45)C3=O)ccc2c1.CCCCCCOc1ccc2cc(OCCOCCN3C(=O)c4cccc5c(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)ccc(c45)C3=O)ccc2c1 |
| InChI | InChI=1S/2C38H32F13NO5/c2*1-2-3-4-5-16-56-24-11-9-23-21-25(12-10-22(23)20-24)57-19-18-55-17-15-52-31(53)27-8-6-7-26-29(14-13-28(30(26)27)32(52)54)33(39,40)34(41,42)35(43,44)36(45,46)37(47,48)38(49,50)51/h2*6-14,20-21H,2-5,15-19H2,1H3 |
| InChIKey | METYALSMIFAGQM-UHFFFAOYSA-N |
| XLogP | 21.68 |
| TPSA | 130.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 114 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1659.30 |
| LogP ≤ 5 | 21.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|