C46H56N4O6 — CID 25149265
6,13-bis[6-[ethyl-[(2-methoxyphenyl)methyl]amino]hexyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone (PubChem CID 25149265) has the molecular formula C46H56N4O6 and a molecular weight of 760.98 g/mol. Its IUPAC name is 6,13-bis[6-[ethyl-[(2-methoxyphenyl)methyl]amino]hexyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone.
| Compound Name | 6,13-bis[6-[ethyl-[(2-methoxyphenyl)methyl]amino]hexyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 25149265 |
| Molecular Formula | C46H56N4O6 |
| Molecular Weight | 760.98 g/mol |
| Exact Mass | 760.42 |
| IUPAC Name | 6,13-bis[6-[ethyl-[(2-methoxyphenyl)methyl]amino]hexyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
| SMILES | CCN(CCCCCCN1C(=O)c2ccc3c4c(ccc(c24)C1=O)C(=O)N(CCCCCCN(CC)Cc1ccccc1OC)C3=O)Cc1ccccc1OC |
| InChI | InChI=1S/C46H56N4O6/c1-5-47(31-33-19-11-13-21-39(33)55-3)27-15-7-9-17-29-49-43(51)35-23-25-37-42-38(26-24-36(41(35)42)44(49)52)46(54)50(45(37)53)30-18-10-8-16-28-48(6-2)32-34-20-12-14-22-40(34)56-4/h11-14,19-26H,5-10,15-18,27-32H2,1-4H3 |
| InChIKey | LMHQZKRKCUDJFH-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 99.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.98 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|