C44H62FN5O2 — CID 139179996
1-N,3-N-bis(2,3-dimethyl-1H-indol-7-yl)benzene-1,3-dicarboxamide;tetrabutylazanium;fluoride (PubChem CID 139179996) has the molecular formula C44H62FN5O2 and a molecular weight of 712.01 g/mol. Its IUPAC name is 1-N,3-N-bis(2,3-dimethyl-1H-indol-7-yl)benzene-1,3-dicarboxamide;tetrabutylazanium;fluoride.
| Compound Name | 1-N,3-N-bis(2,3-dimethyl-1H-indol-7-yl)benzene-1,3-dicarboxamide;tetrabutylazanium;fluoride |
|---|---|
| PubChem CID | 139179996 |
| Molecular Formula | C44H62FN5O2 |
| Molecular Weight | 712.01 g/mol |
| Exact Mass | 711.49 |
| IUPAC Name | 1-N,3-N-bis(2,3-dimethyl-1H-indol-7-yl)benzene-1,3-dicarboxamide;tetrabutylazanium;fluoride |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.Cc1[nH]c2c(NC(=O)c3cccc(C(=O)Nc4cccc5c(C)c(C)[nH]c45)c3)cccc2c1C.[F-] |
| InChI | InChI=1S/C28H26N4O2.C16H36N.FH/c1-15-17(3)29-25-21(15)10-6-12-23(25)31-27(33)19-8-5-9-20(14-19)28(34)32-24-13-7-11-22-16(2)18(4)30-26(22)24;1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;/h5-14,29-30H,1-4H3,(H,31,33)(H,32,34);5-16H2,1-4H3;1H/q;+1;/p-1 |
| InChIKey | DXCLXUGVKADOBR-UHFFFAOYSA-M |
| XLogP | 8.40 |
| TPSA | 89.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.01 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|