C12H8F12I2N2 — CID 139180286
1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-1,6-diiodohexane;hexanedinitrile (PubChem CID 139180286) has the molecular formula C12H8F12I2N2 and a molecular weight of 661.99 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-1,6-diiodohexane;hexanedinitrile.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-1,6-diiodohexane;hexanedinitrile |
|---|---|
| PubChem CID | 139180286 |
| Molecular Formula | C12H8F12I2N2 |
| Molecular Weight | 661.99 g/mol |
| Exact Mass | 661.86 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-1,6-diiodohexane;hexanedinitrile |
| SMILES | FC(F)(I)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)I.N#CCCCCC#N |
| InChI | InChI=1S/C6F12I2.C6H8N2/c7-1(8,3(11,12)5(15,16)19)2(9,10)4(13,14)6(17,18)20;7-5-3-1-2-4-6-8/h;1-4H2 |
| InChIKey | YINUSCAFDCRGRM-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.99 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|