C16H12F6N2O2Pd — CID 139180940
2-[3,5-bis(trifluoromethyl)pyrrol-1-id-2-yl]pyridine;(Z)-4-oxopent-2-en-2-olate;palladium(2+) (PubChem CID 139180940) has the molecular formula C16H12F6N2O2Pd and a molecular weight of 484.69 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)pyrrol-1-id-2-yl]pyridine;(Z)-4-oxopent-2-en-2-olate;palladium(2+).
| Compound Name | 2-[3,5-bis(trifluoromethyl)pyrrol-1-id-2-yl]pyridine;(Z)-4-oxopent-2-en-2-olate;palladium(2+) |
|---|---|
| PubChem CID | 139180940 |
| Molecular Formula | C16H12F6N2O2Pd |
| Molecular Weight | 484.69 g/mol |
| Exact Mass | 483.98 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)pyrrol-1-id-2-yl]pyridine;(Z)-4-oxopent-2-en-2-olate;palladium(2+) |
| SMILES | CC(=O)/C=C(/C)[O-].FC(F)(F)c1cc(C(F)(F)F)c(-c2ccccn2)[n-]1.[Pd+2] |
| InChI | InChI=1S/C11H5F6N2.C5H8O2.Pd/c12-10(13,14)6-5-8(11(15,16)17)19-9(6)7-3-1-2-4-18-7;1-4(6)3-5(2)7;/h1-5H;3,6H,1-2H3;/q-1;;+2/p-1/b;4-3-; |
| InChIKey | FJXNBHCVLRQMMD-LWFKIUJUSA-M |
| XLogP | 3.58 |
| TPSA | 67.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.69 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|