C16H12F6N2O2Pd — CID 139180941
2-(3,5-dimethylpyrrol-1-id-2-yl)pyridine;(Z)-1,1,1,5,5,5-hexafluoro-4-oxopent-2-en-2-olate;palladium(2+) (PubChem CID 139180941) has the molecular formula C16H12F6N2O2Pd and a molecular weight of 484.69 g/mol. Its IUPAC name is 2-(3,5-dimethylpyrrol-1-id-2-yl)pyridine;(Z)-1,1,1,5,5,5-hexafluoro-4-oxopent-2-en-2-olate;palladium(2+).
| Compound Name | 2-(3,5-dimethylpyrrol-1-id-2-yl)pyridine;(Z)-1,1,1,5,5,5-hexafluoro-4-oxopent-2-en-2-olate;palladium(2+) |
|---|---|
| PubChem CID | 139180941 |
| Molecular Formula | C16H12F6N2O2Pd |
| Molecular Weight | 484.69 g/mol |
| Exact Mass | 483.98 |
| IUPAC Name | 2-(3,5-dimethylpyrrol-1-id-2-yl)pyridine;(Z)-1,1,1,5,5,5-hexafluoro-4-oxopent-2-en-2-olate;palladium(2+) |
| SMILES | Cc1cc(C)c(-c2ccccn2)[n-]1.O=C(/C=C(\[O-])C(F)(F)F)C(F)(F)F.[Pd+2] |
| InChI | InChI=1S/C11H11N2.C5H2F6O2.Pd/c1-8-7-9(2)13-11(8)10-5-3-4-6-12-10;6-4(7,8)2(12)1-3(13)5(9,10)11;/h3-7H,1-2H3;1,12H;/q-1;;+2/p-1/b;2-1-; |
| InChIKey | CAGGGALESIPLSU-FJOGWHKWSA-M |
| XLogP | 3.24 |
| TPSA | 67.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.69 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|