C31H31NO3 — CID 139181104
ethyl (1R,8R,9S,12S,16S)-11-benzyl-10-oxo-8-phenyl-11-azatetracyclo[7.6.1.02,7.012,16]hexadeca-2(7),3,5-triene-4-carboxylate (PubChem CID 139181104) has the molecular formula C31H31NO3 and a molecular weight of 465.59 g/mol. Its IUPAC name is ethyl (1R,8R,9S,12S,16S)-11-benzyl-10-oxo-8-phenyl-11-azatetracyclo[7.6.1.02,7.012,16]hexadeca-2(7),3,5-triene-4-carboxylate.
| Compound Name | ethyl (1R,8R,9S,12S,16S)-11-benzyl-10-oxo-8-phenyl-11-azatetracyclo[7.6.1.02,7.012,16]hexadeca-2(7),3,5-triene-4-carboxylate |
|---|---|
| PubChem CID | 139181104 |
| Molecular Formula | C31H31NO3 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | ethyl (1R,8R,9S,12S,16S)-11-benzyl-10-oxo-8-phenyl-11-azatetracyclo[7.6.1.02,7.012,16]hexadeca-2(7),3,5-triene-4-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)[C@@H]1CCC[C@H]3[C@@H]1[C@@H](C(=O)N3Cc1ccccc1)[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C31H31NO3/c1-2-35-31(34)22-16-17-24-25(18-22)23-14-9-15-26-28(23)29(27(24)21-12-7-4-8-13-21)30(33)32(26)19-20-10-5-3-6-11-20/h3-8,10-13,16-18,23,26-29H,2,9,14-15,19H2,1H3/t23-,26-,27+,28+,29-/m0/s1 |
| InChIKey | BATJVNAVWBGMIB-OANXNEKNSA-N |
| XLogP | 5.92 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |