C30H28FNO3 — CID 16746371
methyl 4-[4-[(1R,3aS,4R,7aS)-2-benzyl-4-methyl-3-oxo-3a,4,5,7a-tetrahydro-1H-isoindol-1-yl]-3-fluorophenyl]benzoate (PubChem CID 16746371) has the molecular formula C30H28FNO3 and a molecular weight of 469.56 g/mol. Its IUPAC name is methyl 4-[4-[(1R,3aS,4R,7aS)-2-benzyl-4-methyl-3-oxo-3a,4,5,7a-tetrahydro-1H-isoindol-1-yl]-3-fluorophenyl]benzoate.
| Compound Name | methyl 4-[4-[(1R,3aS,4R,7aS)-2-benzyl-4-methyl-3-oxo-3a,4,5,7a-tetrahydro-1H-isoindol-1-yl]-3-fluorophenyl]benzoate |
|---|---|
| PubChem CID | 16746371 |
| Molecular Formula | C30H28FNO3 |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | methyl 4-[4-[(1R,3aS,4R,7aS)-2-benzyl-4-methyl-3-oxo-3a,4,5,7a-tetrahydro-1H-isoindol-1-yl]-3-fluorophenyl]benzoate |
| SMILES | COC(=O)c1ccc(-c2ccc([C@H]3[C@H]4C=CC[C@@H](C)[C@@H]4C(=O)N3Cc3ccccc3)c(F)c2)cc1 |
| InChI | InChI=1S/C30H28FNO3/c1-19-7-6-10-25-27(19)29(33)32(18-20-8-4-3-5-9-20)28(25)24-16-15-23(17-26(24)31)21-11-13-22(14-12-21)30(34)35-2/h3-6,8-17,19,25,27-28H,7,18H2,1-2H3/t19-,25+,27+,28+/m1/s1 |
| InChIKey | BZJZORSWXAMUTC-UAWBZUDJSA-N |
| XLogP | 6.19 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|