C18H20FNO2 — CID 139182423
(2S,3R)-2-fluoro-3-hydroxy-3-phenyl-N-[(1S)-1-phenylethyl]butanamide (PubChem CID 139182423) has the molecular formula C18H20FNO2 and a molecular weight of 301.36 g/mol. Its IUPAC name is (2S,3R)-2-fluoro-3-hydroxy-3-phenyl-N-[(1S)-1-phenylethyl]butanamide.
| Compound Name | (2S,3R)-2-fluoro-3-hydroxy-3-phenyl-N-[(1S)-1-phenylethyl]butanamide |
|---|---|
| PubChem CID | 139182423 |
| Molecular Formula | C18H20FNO2 |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | (2S,3R)-2-fluoro-3-hydroxy-3-phenyl-N-[(1S)-1-phenylethyl]butanamide |
| SMILES | C[C@H](NC(=O)[C@@H](F)[C@](C)(O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H20FNO2/c1-13(14-9-5-3-6-10-14)20-17(21)16(19)18(2,22)15-11-7-4-8-12-15/h3-13,16,22H,1-2H3,(H,20,21)/t13-,16+,18+/m0/s1 |
| InChIKey | FPOBROQBDRADQK-FDQGKXFDSA-N |
| XLogP | 3.11 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |