C22H27FN2O4 — CID 53340546
4-[1-(4-fluorophenyl)-1-hydroxyethyl]-N-[7-(hydroxyamino)-7-oxoheptyl]benzamide (PubChem CID 53340546) has the molecular formula C22H27FN2O4 and a molecular weight of 402.47 g/mol. Its IUPAC name is 4-[1-(4-fluorophenyl)-1-hydroxyethyl]-N-[7-(hydroxyamino)-7-oxoheptyl]benzamide.
| Compound Name | 4-[1-(4-fluorophenyl)-1-hydroxyethyl]-N-[7-(hydroxyamino)-7-oxoheptyl]benzamide |
|---|---|
| PubChem CID | 53340546 |
| Molecular Formula | C22H27FN2O4 |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | 4-[1-(4-fluorophenyl)-1-hydroxyethyl]-N-[7-(hydroxyamino)-7-oxoheptyl]benzamide |
| SMILES | CC(O)(c1ccc(F)cc1)c1ccc(C(=O)NCCCCCCC(=O)NO)cc1 |
| InChI | InChI=1S/C22H27FN2O4/c1-22(28,18-11-13-19(23)14-12-18)17-9-7-16(8-10-17)21(27)24-15-5-3-2-4-6-20(26)25-29/h7-14,28-29H,2-6,15H2,1H3,(H,24,27)(H,25,26) |
| InChIKey | PQSDQJDMOKAKSB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|