C78H70N4O4S2 — CID 139182885
hexane;bis(5-methyl-1-(4-methylphenyl)sulfonyl-2-phenyl-4-(2-phenylindol-1-yl)indole) (PubChem CID 139182885) has the molecular formula C78H70N4O4S2 and a molecular weight of 1191.58 g/mol. Its IUPAC name is hexane;bis(5-methyl-1-(4-methylphenyl)sulfonyl-2-phenyl-4-(2-phenylindol-1-yl)indole).
| Compound Name | hexane;bis(5-methyl-1-(4-methylphenyl)sulfonyl-2-phenyl-4-(2-phenylindol-1-yl)indole) |
|---|---|
| PubChem CID | 139182885 |
| Molecular Formula | C78H70N4O4S2 |
| Molecular Weight | 1191.58 g/mol |
| Exact Mass | 1190.48 |
| IUPAC Name | hexane;bis(5-methyl-1-(4-methylphenyl)sulfonyl-2-phenyl-4-(2-phenylindol-1-yl)indole) |
| SMILES | CCCCCC.Cc1ccc(S(=O)(=O)n2c(-c3ccccc3)cc3c(-n4c(-c5ccccc5)cc5ccccc54)c(C)ccc32)cc1.Cc1ccc(S(=O)(=O)n2c(-c3ccccc3)cc3c(-n4c(-c5ccccc5)cc5ccccc54)c(C)ccc32)cc1 |
| InChI | InChI=1S/2C36H28N2O2S.C6H14/c2*1-25-17-20-30(21-18-25)41(39,40)38-33-22-19-26(2)36(31(33)24-35(38)28-13-7-4-8-14-28)37-32-16-10-9-15-29(32)23-34(37)27-11-5-3-6-12-27;1-3-5-6-4-2/h2*3-24H,1-2H3;3-6H2,1-2H3 |
| InChIKey | JPDSYUVBDWANAC-UHFFFAOYSA-N |
| XLogP | 20.13 |
| TPSA | 88.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 88 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1191.58 |
| LogP ≤ 5 | 20.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|