C25H42B3NO6 — CID 139183272
4,4,5,5-tetramethyl-8',8'-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1,3-dioxa-2-boranuidacyclopentane-2,9'-1-azonia-9-boranuidabicyclo[4.3.0]nona-1,3,5-triene] (PubChem CID 139183272) has the molecular formula C25H42B3NO6 and a molecular weight of 485.05 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-8',8'-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1,3-dioxa-2-boranuidacyclopentane-2,9'-1-azonia-9-boranuidabicyclo[4.3.0]nona-1,3,5-triene].
| Compound Name | 4,4,5,5-tetramethyl-8',8'-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1,3-dioxa-2-boranuidacyclopentane-2,9'-1-azonia-9-boranuidabicyclo[4.3.0]nona-1,3,5-triene] |
|---|---|
| PubChem CID | 139183272 |
| Molecular Formula | C25H42B3NO6 |
| Molecular Weight | 485.05 g/mol |
| Exact Mass | 485.33 |
| IUPAC Name | 4,4,5,5-tetramethyl-8',8'-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1,3-dioxa-2-boranuidacyclopentane-2,9'-1-azonia-9-boranuidabicyclo[4.3.0]nona-1,3,5-triene] |
| SMILES | CC1(C)OB(C2(B3OC(C)(C)C(C)(C)O3)Cc3cccc[n+]3[B-]23OC(C)(C)C(C)(C)O3)OC1(C)C |
| InChI | InChI=1S/C25H42B3NO6/c1-19(2)20(3,4)31-26(30-19)25(27-32-21(5,6)22(7,8)33-27)17-18-15-13-14-16-29(18)28(25)34-23(9,10)24(11,12)35-28/h13-16H,17H2,1-12H3 |
| InChIKey | IYSRSGXCJRVDAO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 59.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.05 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|