C36H31NO3S2 — CID 139184854
(2S,3S)-N-(4-methylphenyl)sulfonyl-N,2,3-triphenyl-2-phenylsulfanylpent-4-enamide (PubChem CID 139184854) has the molecular formula C36H31NO3S2 and a molecular weight of 589.78 g/mol. Its IUPAC name is (2S,3S)-N-(4-methylphenyl)sulfonyl-N,2,3-triphenyl-2-phenylsulfanylpent-4-enamide.
| Compound Name | (2S,3S)-N-(4-methylphenyl)sulfonyl-N,2,3-triphenyl-2-phenylsulfanylpent-4-enamide |
|---|---|
| PubChem CID | 139184854 |
| Molecular Formula | C36H31NO3S2 |
| Molecular Weight | 589.78 g/mol |
| Exact Mass | 589.17 |
| IUPAC Name | (2S,3S)-N-(4-methylphenyl)sulfonyl-N,2,3-triphenyl-2-phenylsulfanylpent-4-enamide |
| SMILES | C=C[C@@H](c1ccccc1)[C@@](Sc1ccccc1)(C(=O)N(c1ccccc1)S(=O)(=O)c1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C36H31NO3S2/c1-3-34(29-16-8-4-9-17-29)36(30-18-10-5-11-19-30,41-32-22-14-7-15-23-32)35(38)37(31-20-12-6-13-21-31)42(39,40)33-26-24-28(2)25-27-33/h3-27,34H,1H2,2H3/t34-,36+/m0/s1 |
| InChIKey | AWIMWCXZJHXQMG-PUDHBBIYSA-N |
| XLogP | 8.37 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.78 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|