C50H32F12N4S4 — CID 139185087
4-[4-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-5-pyridin-4-ylthiophen-3-yl)cyclopenten-1-yl]-5-methylthiophen-2-yl]pyridine (PubChem CID 139185087) has the molecular formula C50H32F12N4S4 and a molecular weight of 1045.08 g/mol. Its IUPAC name is 4-[4-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-5-pyridin-4-ylthiophen-3-yl)cyclopenten-1-yl]-5-methylthiophen-2-yl]pyridine.
| Compound Name | 4-[4-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-5-pyridin-4-ylthiophen-3-yl)cyclopenten-1-yl]-5-methylthiophen-2-yl]pyridine |
|---|---|
| PubChem CID | 139185087 |
| Molecular Formula | C50H32F12N4S4 |
| Molecular Weight | 1045.08 g/mol |
| Exact Mass | 1044.13 |
| IUPAC Name | 4-[4-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-5-pyridin-4-ylthiophen-3-yl)cyclopenten-1-yl]-5-methylthiophen-2-yl]pyridine |
| SMILES | Cc1sc(-c2ccncc2)cc1C1=C(c2cc(-c3ccncc3)sc2C)C(F)(F)C(F)(F)C1(F)F.Cc1sc(-c2ccncc2)cc1C1=C(c2cc(-c3ccncc3)sc2C)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/2C25H16F6N2S2/c2*1-13-17(11-19(34-13)15-3-7-32-8-4-15)21-22(24(28,29)25(30,31)23(21,26)27)18-12-20(35-14(18)2)16-5-9-33-10-6-16/h2*3-12H,1-2H3 |
| InChIKey | YHHAMDHNTDFPTF-UHFFFAOYSA-N |
| XLogP | 16.76 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1045.08 |
| LogP ≤ 5 | 16.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|