C15H20F3N4O3PS3 — CID 139186894
1-[[4-(dimethylamino)pyridin-1-ium-1-yl]-sulfidophosphinothioyl]-N,N-dimethylpyridin-1-ium-4-amine;trifluoromethanesulfonate (PubChem CID 139186894) has the molecular formula C15H20F3N4O3PS3 and a molecular weight of 488.52 g/mol. Its IUPAC name is 1-[[4-(dimethylamino)pyridin-1-ium-1-yl]-sulfidophosphinothioyl]-N,N-dimethylpyridin-1-ium-4-amine;trifluoromethanesulfonate.
| Compound Name | 1-[[4-(dimethylamino)pyridin-1-ium-1-yl]-sulfidophosphinothioyl]-N,N-dimethylpyridin-1-ium-4-amine;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139186894 |
| Molecular Formula | C15H20F3N4O3PS3 |
| Molecular Weight | 488.52 g/mol |
| Exact Mass | 488.04 |
| IUPAC Name | 1-[[4-(dimethylamino)pyridin-1-ium-1-yl]-sulfidophosphinothioyl]-N,N-dimethylpyridin-1-ium-4-amine;trifluoromethanesulfonate |
| SMILES | CN(C)c1cc[n+](P(=S)([S-])[n+]2ccc(N(C)C)cc2)cc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C14H20N4PS2.CHF3O3S/c1-15(2)13-5-9-17(10-6-13)19(20,21)18-11-7-14(8-12-18)16(3)4;2-1(3,4)8(5,6)7/h5-12H,1-4H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | PNWWNBLRVRVUBN-UHFFFAOYSA-M |
| XLogP | 1.61 |
| TPSA | 71.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.52 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|