C13H19N3O2S — CID 3234316
7-methylsulfonyl-2-pyridin-4-yl-2,7-diazaspiro[3.5]nonane (PubChem CID 3234316) has the molecular formula C13H19N3O2S and a molecular weight of 281.38 g/mol. Its IUPAC name is 7-methylsulfonyl-2-pyridin-4-yl-2,7-diazaspiro[3.5]nonane.
| Compound Name | 7-methylsulfonyl-2-pyridin-4-yl-2,7-diazaspiro[3.5]nonane |
|---|---|
| PubChem CID | 3234316 |
| Molecular Formula | C13H19N3O2S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 7-methylsulfonyl-2-pyridin-4-yl-2,7-diazaspiro[3.5]nonane |
| SMILES | CS(=O)(=O)N1CCC2(CC1)CN(c1ccncc1)C2 |
| InChI | InChI=1S/C13H19N3O2S/c1-19(17,18)16-8-4-13(5-9-16)10-15(11-13)12-2-6-14-7-3-12/h2-3,6-7H,4-5,8-11H2,1H3 |
| InChIKey | WEDGSLIEZXGZBN-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |