C28H28F10N2O2 — CID 139186958
(3R)-3-benzyl-1-methyl-3-(1,1,2,2,2-pentafluoroethyl)pyrrolidin-2-one (PubChem CID 139186958) has the molecular formula C28H28F10N2O2 and a molecular weight of 614.52 g/mol. Its IUPAC name is (3R)-3-benzyl-1-methyl-3-(1,1,2,2,2-pentafluoroethyl)pyrrolidin-2-one.
| Compound Name | (3R)-3-benzyl-1-methyl-3-(1,1,2,2,2-pentafluoroethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 139186958 |
| Molecular Formula | C28H28F10N2O2 |
| Molecular Weight | 614.52 g/mol |
| Exact Mass | 614.20 |
| IUPAC Name | (3R)-3-benzyl-1-methyl-3-(1,1,2,2,2-pentafluoroethyl)pyrrolidin-2-one |
| SMILES | CN1CC[C@@](Cc2ccccc2)(C(F)(F)C(F)(F)F)C1=O.CN1CC[C@@](Cc2ccccc2)(C(F)(F)C(F)(F)F)C1=O |
| InChI | InChI=1S/2C14H14F5NO/c2*1-20-8-7-12(11(20)21,13(15,16)14(17,18)19)9-10-5-3-2-4-6-10/h2*2-6H,7-9H2,1H3/t2*12-/m00/s1 |
| InChIKey | KAJQTWFBMWKVPJ-ILSZIBLNSA-N |
| XLogP | 6.55 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.52 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|