C18H16FNO — CID 139187280
(2S)-2-(fluoromethyl)-6-methyl-2,4-diphenyl-1,3-oxazine (PubChem CID 139187280) has the molecular formula C18H16FNO and a molecular weight of 281.33 g/mol. Its IUPAC name is (2S)-2-(fluoromethyl)-6-methyl-2,4-diphenyl-1,3-oxazine.
| Compound Name | (2S)-2-(fluoromethyl)-6-methyl-2,4-diphenyl-1,3-oxazine |
|---|---|
| PubChem CID | 139187280 |
| Molecular Formula | C18H16FNO |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | (2S)-2-(fluoromethyl)-6-methyl-2,4-diphenyl-1,3-oxazine |
| SMILES | CC1=CC(c2ccccc2)=N[C@@](CF)(c2ccccc2)O1 |
| InChI | InChI=1S/C18H16FNO/c1-14-12-17(15-8-4-2-5-9-15)20-18(13-19,21-14)16-10-6-3-7-11-16/h2-12H,13H2,1H3/t18-/m1/s1 |
| InChIKey | KUFFCPKTHSSTCR-GOSISDBHSA-N |
| XLogP | 4.23 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |