C18H11F6NO — CID 13048285
2,6-diphenyl-4,4-bis(trifluoromethyl)-1,3-oxazine (PubChem CID 13048285) has the molecular formula C18H11F6NO and a molecular weight of 371.28 g/mol. Its IUPAC name is 2,6-diphenyl-4,4-bis(trifluoromethyl)-1,3-oxazine.
| Compound Name | 2,6-diphenyl-4,4-bis(trifluoromethyl)-1,3-oxazine |
|---|---|
| PubChem CID | 13048285 |
| Molecular Formula | C18H11F6NO |
| Molecular Weight | 371.28 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | 2,6-diphenyl-4,4-bis(trifluoromethyl)-1,3-oxazine |
| SMILES | FC(F)(F)C1(C(F)(F)F)C=C(c2ccccc2)OC(c2ccccc2)=N1 |
| InChI | InChI=1S/C18H11F6NO/c19-17(20,21)16(18(22,23)24)11-14(12-7-3-1-4-8-12)26-15(25-16)13-9-5-2-6-10-13/h1-11H |
| InChIKey | MSKKVUXPRIWORB-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.28 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |