C17H22O4S — CID 139187850
[(3aR,4R,7aS)-7a-methyl-1-oxo-3,3a,4,5,6,7-hexahydro-2H-inden-4-yl] 4-methylbenzenesulfonate (PubChem CID 139187850) has the molecular formula C17H22O4S and a molecular weight of 322.43 g/mol. Its IUPAC name is [(3aR,4R,7aS)-7a-methyl-1-oxo-3,3a,4,5,6,7-hexahydro-2H-inden-4-yl] 4-methylbenzenesulfonate.
| Compound Name | [(3aR,4R,7aS)-7a-methyl-1-oxo-3,3a,4,5,6,7-hexahydro-2H-inden-4-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 139187850 |
| Molecular Formula | C17H22O4S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | [(3aR,4R,7aS)-7a-methyl-1-oxo-3,3a,4,5,6,7-hexahydro-2H-inden-4-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H]2CCC[C@]3(C)C(=O)CC[C@@H]23)cc1 |
| InChI | InChI=1S/C17H22O4S/c1-12-5-7-13(8-6-12)22(19,20)21-15-4-3-11-17(2)14(15)9-10-16(17)18/h5-8,14-15H,3-4,9-11H2,1-2H3/t14-,15+,17-/m0/s1 |
| InChIKey | LDVDLZLAJQDUQN-UXLLHSPISA-N |
| XLogP | 3.24 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|