C54H57B3O9S3 — CID 139189875
2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxathiine (PubChem CID 139189875) has the molecular formula C54H57B3O9S3 and a molecular weight of 978.68 g/mol. Its IUPAC name is 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxathiine.
| Compound Name | 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxathiine |
|---|---|
| PubChem CID | 139189875 |
| Molecular Formula | C54H57B3O9S3 |
| Molecular Weight | 978.68 g/mol |
| Exact Mass | 978.34 |
| IUPAC Name | 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxathiine |
| SMILES | CC1(C)OB(c2ccc3c(c2)Sc2ccccc2O3)OC1(C)C.CC1(C)OB(c2ccc3c(c2)Sc2ccccc2O3)OC1(C)C.CC1(C)OB(c2ccc3c(c2)Sc2ccccc2O3)OC1(C)C |
| InChI | InChI=1S/3C18H19BO3S/c3*1-17(2)18(3,4)22-19(21-17)12-9-10-14-16(11-12)23-15-8-6-5-7-13(15)20-14/h3*5-11H,1-4H3 |
| InChIKey | ZGWNXTSUQZAHMK-UHFFFAOYSA-N |
| XLogP | 12.73 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 69 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 978.68 |
| LogP ≤ 5 | 12.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|