C19H26N2O4S — CID 139189886
ethyl (1R,2E,5R)-3-tert-butyl-2-(4-methylphenyl)sulfonylimino-3-azabicyclo[3.1.0]hexane-1-carboxylate (PubChem CID 139189886) has the molecular formula C19H26N2O4S and a molecular weight of 378.49 g/mol. Its IUPAC name is ethyl (1R,2E,5R)-3-tert-butyl-2-(4-methylphenyl)sulfonylimino-3-azabicyclo[3.1.0]hexane-1-carboxylate.
| Compound Name | ethyl (1R,2E,5R)-3-tert-butyl-2-(4-methylphenyl)sulfonylimino-3-azabicyclo[3.1.0]hexane-1-carboxylate |
|---|---|
| PubChem CID | 139189886 |
| Molecular Formula | C19H26N2O4S |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | ethyl (1R,2E,5R)-3-tert-butyl-2-(4-methylphenyl)sulfonylimino-3-azabicyclo[3.1.0]hexane-1-carboxylate |
| SMILES | CCOC(=O)[C@]12C[C@H]1CN(C(C)(C)C)C2=NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H26N2O4S/c1-6-25-17(22)19-11-14(19)12-21(18(3,4)5)16(19)20-26(23,24)15-9-7-13(2)8-10-15/h7-10,14H,6,11-12H2,1-5H3/t14-,19+/m0/s1 |
| InChIKey | YPFHJGNMYZCSFD-IFXJQAMLSA-N |
| XLogP | 2.77 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|