C39H38N4O5 — CID 139190220
methyl (5R,6E,8E,9S)-6-(1-methoxy-1-oxopropan-2-ylidene)-7-(4-methoxyphenyl)-1,3,4-triphenyl-8-propylidene-1,2,4,7-tetrazaspiro[4.4]non-2-ene-9-carboxylate (PubChem CID 139190220) has the molecular formula C39H38N4O5 and a molecular weight of 642.76 g/mol. Its IUPAC name is methyl (5R,6E,8E,9S)-6-(1-methoxy-1-oxopropan-2-ylidene)-7-(4-methoxyphenyl)-1,3,4-triphenyl-8-propylidene-1,2,4,7-tetrazaspiro[4.4]non-2-ene-9-carboxylate.
| Compound Name | methyl (5R,6E,8E,9S)-6-(1-methoxy-1-oxopropan-2-ylidene)-7-(4-methoxyphenyl)-1,3,4-triphenyl-8-propylidene-1,2,4,7-tetrazaspiro[4.4]non-2-ene-9-carboxylate |
|---|---|
| PubChem CID | 139190220 |
| Molecular Formula | C39H38N4O5 |
| Molecular Weight | 642.76 g/mol |
| Exact Mass | 642.28 |
| IUPAC Name | methyl (5R,6E,8E,9S)-6-(1-methoxy-1-oxopropan-2-ylidene)-7-(4-methoxyphenyl)-1,3,4-triphenyl-8-propylidene-1,2,4,7-tetrazaspiro[4.4]non-2-ene-9-carboxylate |
| SMILES | CC/C=C1\[C@H](C(=O)OC)[C@]2(/C(=C(/C)C(=O)OC)N1c1ccc(OC)cc1)N(c1ccccc1)N=C(c1ccccc1)N2c1ccccc1 |
| InChI | InChI=1S/C39H38N4O5/c1-6-16-33-34(38(45)48-5)39(35(27(2)37(44)47-4)41(33)29-23-25-32(46-3)26-24-29)42(30-19-12-8-13-20-30)36(28-17-10-7-11-18-28)40-43(39)31-21-14-9-15-22-31/h7-26,34H,6H2,1-5H3/b33-16+,35-27+/t34-,39-/m1/s1 |
| InChIKey | LKAMVTUZDUEJSG-MTSICNLGSA-N |
| XLogP | 7.13 |
| TPSA | 83.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.76 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|