C40H34N4O3S — CID 25266134
methyl (5S,8E,9R)-4-(4-methoxyphenyl)-1,3,7-triphenyl-8-(2-phenylethylidene)-6-sulfanylidene-1,2,4,7-tetrazaspiro[4.4]non-2-ene-9-carboxylate (PubChem CID 25266134) has the molecular formula C40H34N4O3S and a molecular weight of 650.80 g/mol. Its IUPAC name is methyl (5S,8E,9R)-4-(4-methoxyphenyl)-1,3,7-triphenyl-8-(2-phenylethylidene)-6-sulfanylidene-1,2,4,7-tetrazaspiro[4.4]non-2-ene-9-carboxylate.
| Compound Name | methyl (5S,8E,9R)-4-(4-methoxyphenyl)-1,3,7-triphenyl-8-(2-phenylethylidene)-6-sulfanylidene-1,2,4,7-tetrazaspiro[4.4]non-2-ene-9-carboxylate |
|---|---|
| PubChem CID | 25266134 |
| Molecular Formula | C40H34N4O3S |
| Molecular Weight | 650.80 g/mol |
| Exact Mass | 650.24 |
| IUPAC Name | methyl (5S,8E,9R)-4-(4-methoxyphenyl)-1,3,7-triphenyl-8-(2-phenylethylidene)-6-sulfanylidene-1,2,4,7-tetrazaspiro[4.4]non-2-ene-9-carboxylate |
| SMILES | COC(=O)[C@@H]1/C(=C\Cc2ccccc2)N(c2ccccc2)C(=S)[C@@]12N(c1ccccc1)N=C(c1ccccc1)N2c1ccc(OC)cc1 |
| InChI | InChI=1S/C40H34N4O3S/c1-46-34-26-24-32(25-27-34)43-37(30-17-9-4-10-18-30)41-44(33-21-13-6-14-22-33)40(43)36(38(45)47-2)35(28-23-29-15-7-3-8-16-29)42(39(40)48)31-19-11-5-12-20-31/h3-22,24-28,36H,23H2,1-2H3/b35-28+/t36-,40-/m0/s1 |
| InChIKey | JWWJSRNZCMNFBO-CGFNXNRXSA-N |
| XLogP | 7.84 |
| TPSA | 57.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.80 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|