C70H62N6O4 — CID 139190301
2-(4-methoxy-2,6-dimethylphenyl)-9-[6-(4-methoxy-2,6-dimethylphenyl)-2-pyridinyl]-1,10-phenanthroline (PubChem CID 139190301) has the molecular formula C70H62N6O4 and a molecular weight of 1051.30 g/mol. Its IUPAC name is 2-(4-methoxy-2,6-dimethylphenyl)-9-[6-(4-methoxy-2,6-dimethylphenyl)-2-pyridinyl]-1,10-phenanthroline.
| Compound Name | 2-(4-methoxy-2,6-dimethylphenyl)-9-[6-(4-methoxy-2,6-dimethylphenyl)-2-pyridinyl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 139190301 |
| Molecular Formula | C70H62N6O4 |
| Molecular Weight | 1051.30 g/mol |
| Exact Mass | 1050.48 |
| IUPAC Name | 2-(4-methoxy-2,6-dimethylphenyl)-9-[6-(4-methoxy-2,6-dimethylphenyl)-2-pyridinyl]-1,10-phenanthroline |
| SMILES | COc1cc(C)c(-c2cccc(-c3ccc4ccc5ccc(-c6c(C)cc(OC)cc6C)nc5c4n3)n2)c(C)c1.COc1cc(C)c(-c2cccc(-c3ccc4ccc5ccc(-c6c(C)cc(OC)cc6C)nc5c4n3)n2)c(C)c1 |
| InChI | InChI=1S/2C35H31N3O2/c2*1-20-16-26(39-5)17-21(2)32(20)30-9-7-8-28(36-30)29-14-12-24-10-11-25-13-15-31(38-35(25)34(24)37-29)33-22(3)18-27(40-6)19-23(33)4/h2*7-19H,1-6H3 |
| InChIKey | XQHRPCAPGVHAJZ-UHFFFAOYSA-N |
| XLogP | 16.86 |
| TPSA | 114.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1051.30 |
| LogP ≤ 5 | 16.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|