C31H34N6O — CID 166635790
11-methoxy-3,6-bis(4-methylpiperazin-1-yl)phenanthro[9,10-b]quinoxaline (PubChem CID 166635790) has the molecular formula C31H34N6O and a molecular weight of 506.65 g/mol. Its IUPAC name is 11-methoxy-3,6-bis(4-methylpiperazin-1-yl)phenanthro[9,10-b]quinoxaline.
| Compound Name | 11-methoxy-3,6-bis(4-methylpiperazin-1-yl)phenanthro[9,10-b]quinoxaline |
|---|---|
| PubChem CID | 166635790 |
| Molecular Formula | C31H34N6O |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.28 |
| IUPAC Name | 11-methoxy-3,6-bis(4-methylpiperazin-1-yl)phenanthro[9,10-b]quinoxaline |
| SMILES | COc1ccc2nc3c4ccc(N5CCN(C)CC5)cc4c4cc(N5CCN(C)CC5)ccc4c3nc2c1 |
| InChI | InChI=1S/C31H34N6O/c1-34-10-14-36(15-11-34)21-4-7-24-26(18-21)27-19-22(37-16-12-35(2)13-17-37)5-8-25(27)31-30(24)32-28-9-6-23(38-3)20-29(28)33-31/h4-9,18-20H,10-17H2,1-3H3 |
| InChIKey | ZRRGSBUFPFQDJC-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 47.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_6666_A(2)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|