C17H20N4O — CID 19978049
7-methoxy-4-(4-methylpiperazin-1-yl)pyrrolo[1,2-a]quinoxaline (PubChem CID 19978049) has the molecular formula C17H20N4O and a molecular weight of 296.37 g/mol. Its IUPAC name is 7-methoxy-4-(4-methylpiperazin-1-yl)pyrrolo[1,2-a]quinoxaline.
| Compound Name | 7-methoxy-4-(4-methylpiperazin-1-yl)pyrrolo[1,2-a]quinoxaline |
|---|---|
| PubChem CID | 19978049 |
| Molecular Formula | C17H20N4O |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 7-methoxy-4-(4-methylpiperazin-1-yl)pyrrolo[1,2-a]quinoxaline |
| SMILES | COc1ccc2c(c1)nc(N1CCN(C)CC1)c1cccn12 |
| InChI | InChI=1S/C17H20N4O/c1-19-8-10-20(11-9-19)17-16-4-3-7-21(16)15-6-5-13(22-2)12-14(15)18-17/h3-7,12H,8-11H2,1-2H3 |
| InChIKey | IJZZICZKIQBYDL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 33.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |