C20H20N4OS — CID 70049887
8-[4-(4-methoxyphenyl)piperazin-1-yl]-3-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene (PubChem CID 70049887) has the molecular formula C20H20N4OS and a molecular weight of 364.47 g/mol. Its IUPAC name is 8-[4-(4-methoxyphenyl)piperazin-1-yl]-3-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene.
| Compound Name | 8-[4-(4-methoxyphenyl)piperazin-1-yl]-3-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene |
|---|---|
| PubChem CID | 70049887 |
| Molecular Formula | C20H20N4OS |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 8-[4-(4-methoxyphenyl)piperazin-1-yl]-3-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene |
| SMILES | COc1ccc(N2CCN(c3nc4ccsc4n4cccc34)CC2)cc1 |
| InChI | InChI=1S/C20H20N4OS/c1-25-16-6-4-15(5-7-16)22-10-12-23(13-11-22)19-18-3-2-9-24(18)20-17(21-19)8-14-26-20/h2-9,14H,10-13H2,1H3 |
| InChIKey | FIXQSQGCUJUORI-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 33.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|