C21H20ClN5O — CID 110188007
12-chloro-7-[4-(2-methoxyphenyl)piperazin-1-yl]-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene (PubChem CID 110188007) has the molecular formula C21H20ClN5O and a molecular weight of 393.88 g/mol. Its IUPAC name is 12-chloro-7-[4-(2-methoxyphenyl)piperazin-1-yl]-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene.
| Compound Name | 12-chloro-7-[4-(2-methoxyphenyl)piperazin-1-yl]-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
|---|---|
| PubChem CID | 110188007 |
| Molecular Formula | C21H20ClN5O |
| Molecular Weight | 393.88 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 12-chloro-7-[4-(2-methoxyphenyl)piperazin-1-yl]-2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
| SMILES | COc1ccccc1N1CCN(c2nc3ccc(Cl)nc3n3cccc23)CC1 |
| InChI | InChI=1S/C21H20ClN5O/c1-28-18-7-3-2-5-16(18)25-11-13-26(14-12-25)21-17-6-4-10-27(17)20-15(23-21)8-9-19(22)24-20/h2-10H,11-14H2,1H3 |
| InChIKey | CPIUOQRWLLZBPA-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 45.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.88 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|