C56H62N2O10 — CID 139190524
(2R,4aR,6R,7R,8R,8aS)-7-(dibenzylamino)-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol (PubChem CID 139190524) has the molecular formula C56H62N2O10 and a molecular weight of 923.12 g/mol. Its IUPAC name is (2R,4aR,6R,7R,8R,8aS)-7-(dibenzylamino)-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol.
| Compound Name | (2R,4aR,6R,7R,8R,8aS)-7-(dibenzylamino)-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
|---|---|
| PubChem CID | 139190524 |
| Molecular Formula | C56H62N2O10 |
| Molecular Weight | 923.12 g/mol |
| Exact Mass | 922.44 |
| IUPAC Name | (2R,4aR,6R,7R,8R,8aS)-7-(dibenzylamino)-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
| SMILES | CO[C@@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@H](O)[C@H]1N(Cc1ccccc1)Cc1ccccc1.CO[C@@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@H](O)[C@H]1N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/2C28H31NO5/c2*1-31-28-24(29(17-20-11-5-2-6-12-20)18-21-13-7-3-8-14-21)25(30)26-23(33-28)19-32-27(34-26)22-15-9-4-10-16-22/h2*2-16,23-28,30H,17-19H2,1H3/t2*23-,24-,25-,26-,27-,28-/m11/s1 |
| InChIKey | VDBMVDCEIOPOBT-XAUOKQLTSA-N |
| XLogP | 7.81 |
| TPSA | 120.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 923.12 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |