C16H28O6Si — CID 139190547
ethyl (2S)-4-[ditert-butyl(hydroxy)silyl]oxy-2-methyl-5-oxofuran-2-carboxylate (PubChem CID 139190547) has the molecular formula C16H28O6Si and a molecular weight of 344.48 g/mol. Its IUPAC name is ethyl (2S)-4-[ditert-butyl(hydroxy)silyl]oxy-2-methyl-5-oxofuran-2-carboxylate.
| Compound Name | ethyl (2S)-4-[ditert-butyl(hydroxy)silyl]oxy-2-methyl-5-oxofuran-2-carboxylate |
|---|---|
| PubChem CID | 139190547 |
| Molecular Formula | C16H28O6Si |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | ethyl (2S)-4-[ditert-butyl(hydroxy)silyl]oxy-2-methyl-5-oxofuran-2-carboxylate |
| SMILES | CCOC(=O)[C@]1(C)C=C(O[Si](O)(C(C)(C)C)C(C)(C)C)C(=O)O1 |
| InChI | InChI=1S/C16H28O6Si/c1-9-20-13(18)16(8)10-11(12(17)21-16)22-23(19,14(2,3)4)15(5,6)7/h10,19H,9H2,1-8H3/t16-/m0/s1 |
| InChIKey | NTWLKTPSNBQKJP-INIZCTEOSA-N |
| XLogP | 2.80 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|