C24H40O7Si — CID 91245627
5-O-(2-methylprop-2-enoyl) 1-O-(2-oxo-2-tributylsilyloxyethyl) 2-methylpent-2-enedioate (PubChem CID 91245627) has the molecular formula C24H40O7Si and a molecular weight of 468.66 g/mol. Its IUPAC name is 5-O-(2-methylprop-2-enoyl) 1-O-(2-oxo-2-tributylsilyloxyethyl) 2-methylpent-2-enedioate.
| Compound Name | 5-O-(2-methylprop-2-enoyl) 1-O-(2-oxo-2-tributylsilyloxyethyl) 2-methylpent-2-enedioate |
|---|---|
| PubChem CID | 91245627 |
| Molecular Formula | C24H40O7Si |
| Molecular Weight | 468.66 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | 5-O-(2-methylprop-2-enoyl) 1-O-(2-oxo-2-tributylsilyloxyethyl) 2-methylpent-2-enedioate |
| SMILES | C=C(C)C(=O)OC(=O)CC=C(C)C(=O)OCC(=O)O[Si](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C24H40O7Si/c1-7-10-15-32(16-11-8-2,17-12-9-3)31-22(26)18-29-24(28)20(6)13-14-21(25)30-23(27)19(4)5/h13H,4,7-12,14-18H2,1-3,5-6H3 |
| InChIKey | AOHNKHHEYDCAMR-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.66 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|