C14H24O6Si — CID 141076080
(Z)-3-(2-oxo-2-triethylsilyloxyethoxy)carbonylpent-2-enoic acid (PubChem CID 141076080) has the molecular formula C14H24O6Si and a molecular weight of 316.43 g/mol. Its IUPAC name is (Z)-3-(2-oxo-2-triethylsilyloxyethoxy)carbonylpent-2-enoic acid.
| Compound Name | (Z)-3-(2-oxo-2-triethylsilyloxyethoxy)carbonylpent-2-enoic acid |
|---|---|
| PubChem CID | 141076080 |
| Molecular Formula | C14H24O6Si |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | (Z)-3-(2-oxo-2-triethylsilyloxyethoxy)carbonylpent-2-enoic acid |
| SMILES | CC/C(=C/C(=O)O)C(=O)OCC(=O)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C14H24O6Si/c1-5-11(9-12(15)16)14(18)19-10-13(17)20-21(6-2,7-3)8-4/h9H,5-8,10H2,1-4H3,(H,15,16)/b11-9- |
| InChIKey | QCZVDVZMHXQAPI-LUAWRHEFSA-N |
| XLogP | 2.50 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|