C16H28O6Si — CID 141075951
(Z)-3-methyl-4-oxo-4-[2-oxo-2-tri(propan-2-yl)silyloxyethoxy]but-2-enoic acid (PubChem CID 141075951) has the molecular formula C16H28O6Si and a molecular weight of 344.48 g/mol. Its IUPAC name is (Z)-3-methyl-4-oxo-4-[2-oxo-2-tri(propan-2-yl)silyloxyethoxy]but-2-enoic acid.
| Compound Name | (Z)-3-methyl-4-oxo-4-[2-oxo-2-tri(propan-2-yl)silyloxyethoxy]but-2-enoic acid |
|---|---|
| PubChem CID | 141075951 |
| Molecular Formula | C16H28O6Si |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | (Z)-3-methyl-4-oxo-4-[2-oxo-2-tri(propan-2-yl)silyloxyethoxy]but-2-enoic acid |
| SMILES | C/C(=C/C(=O)O)C(=O)OCC(=O)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C16H28O6Si/c1-10(2)23(11(3)4,12(5)6)22-15(19)9-21-16(20)13(7)8-14(17)18/h8,10-12H,9H2,1-7H3,(H,17,18)/b13-8- |
| InChIKey | FUAUIUKNOLICKH-JYRVWZFOSA-N |
| XLogP | 3.28 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|